* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OXAN-4-YL(THIOPHEN-2-YL)METHANOL |
| English Synonyms: | OXAN-4-YL(THIOPHEN-2-YL)METHANOL |
| MDL Number.: | MFCD17243931 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cc(sc1)C(C2CCOCC2)O |
| InChi: | InChI=1S/C10H14O2S/c11-10(9-2-1-7-13-9)8-3-5-12-6-4-8/h1-2,7-8,10-11H,3-6H2 |
| InChiKey: | InChIKey=IPMRDHCMJHLRBM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.