* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-METHYL-5-(PROPAN-2-YL)-2-(4H-1,2,4-TRIAZOL-3-YL)PYRIMIDIN-4-AMINE |
English Synonyms: | 6-METHYL-5-(PROPAN-2-YL)-2-(4H-1,2,4-TRIAZOL-3-YL)PYRIMIDIN-4-AMINE |
MDL Number.: | MFCD17246607 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | Cc1c(c(nc(n1)c2[nH]cnn2)N)C(C)C |
InChi: | InChI=1S/C10H14N6/c1-5(2)7-6(3)14-10(15-8(7)11)9-12-4-13-16-9/h4-5H,1-3H3,(H2,11,14,15)(H,12,13,16) |
InChiKey: | InChIKey=HPFMWFKPWHBDDO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.