* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-METHYL-3-(PROPAN-2-YL)HEPT-5-EN-2-OL |
English Synonyms: | 6-METHYL-3-(PROPAN-2-YL)HEPT-5-EN-2-OL |
MDL Number.: | MFCD17246786 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC(C)C(CC=C(C)C)C(C)O |
InChi: | InChI=1S/C11H22O/c1-8(2)6-7-11(9(3)4)10(5)12/h6,9-12H,7H2,1-5H3 |
InChiKey: | InChIKey=YDVSHPKMFUYZIG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.