Molecular Structure:
CCD No.:CCD03512663
OTAVA-BB 4217742
Formula:C11 H10 Cl F N2 S
MolWeight:256.731
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 4217742 |
| English Synonyms： | OTAVA-BB 4217742 |
| MDL Number.： | MFCD17251064 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1cc(c(cc1Cl)c2nc(cs2)CCN)F |
| InChi： | InChI=1S/C11H10ClFN2S/c12-7-1-2-10(13)9(5-7)11-15-8(3-4-14)6-16-11/h1-2,5-6H,3-4,14H2 |
| InChiKey： | InChIKey=DRASCRQAURROOP-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
