Molecular Structure:
CCD No.:CCD03512875
OTAVA-BB 1916203
Formula:C11 H9 N O3 S
MolWeight:235.262
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1916203 |
| English Synonyms： | OTAVA-BB 1916203 |
| MDL Number.： | MFCD17251276 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | c1cc2c(cc1c3csc(n3)CO)OCO2 |
| InChi： | InChI=1S/C11H9NO3S/c13-4-11-12-8(5-16-11)7-1-2-9-10(3-7)15-6-14-9/h1-3,5,13H,4,6H2 |
| InChiKey： | InChIKey=RWABLUUDASQMIF-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
