Molecular Structure:
CCD No.:CCD03513347
OTAVA-BB 2103742
Formula:C9 H15 N3 O
MolWeight:181.238
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 2103742 |
| English Synonyms： | OTAVA-BB 2103742 |
| MDL Number.： | MFCD17251753 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CCC(Cn1c(=O)ccc(n1)C)N |
| InChi： | InChI=1S/C9H15N3O/c1-3-8(10)6-12-9(13)5-4-7(2)11-12/h4-5,8H,3,6,10H2,1-2H3 |
| InChiKey： | InChIKey=LRPCBXOSUKORCM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
