* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PHARMABLOCK PBN20120950 |
English Synonyms: | PHARMABLOCK PBN20120950 |
MDL Number.: | MFCD17255308 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cn1cnc(n1)CN |
InChi: | InChI=1S/C4H8N4/c1-8-3-6-4(2-5)7-8/h3H,2,5H2,1H3 |
InChiKey: | InChIKey=SVCVEWHURPUENH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.