* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHYL-1H,2H,3H-PYRROLO[3,2-H]QUINOLINE-2,3-DIONE |
| English Synonyms: | 8-METHYL-1H,2H,3H-PYRROLO[3,2-H]QUINOLINE-2,3-DIONE |
| MDL Number.: | MFCD17259587 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1ccc2ccc3c(c2n1)NC(=O)C3=O |
| InChi: | InChI=1S/C12H8N2O2/c1-6-2-3-7-4-5-8-10(9(7)13-6)14-12(16)11(8)15/h2-5H,1H3,(H,14,15,16) |
| InChiKey: | InChIKey=RAAWNYBUCHLUSZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.