Molecular Structure:
CCD No.:CCD03522452
OTAVA-BB 2026881
Formula:C10 H16 N2 O
MolWeight:180.249
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 2026881 |
| English Synonyms： | OTAVA-BB 2026881 |
| MDL Number.： | MFCD17261093 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CCC(Cn1ccc(cc1=O)C)N |
| InChi： | InChI=1S/C10H16N2O/c1-3-9(11)7-12-5-4-8(2)6-10(12)13/h4-6,9H,3,7,11H2,1-2H3 |
| InChiKey： | InChIKey=SNUFGMAQGVDKIX-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
