Molecular Structure:
CCD No.:CCD03522478
OTAVA-BB 2026227
Formula:C9 H10 N2 O
MolWeight:162.191
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 2026227 |
| English Synonyms： | OTAVA-BB 2026227 |
| MDL Number.： | MFCD17261119 |
| H bond acceptor： | 3 |
| H bond donor： | 0 |
| Smile： | Cc1ccn(c(=O)c1)CCC#N |
| InChi： | InChI=1S/C9H10N2O/c1-8-3-6-11(5-2-4-10)9(12)7-8/h3,6-7H,2,5H2,1H3 |
| InChiKey： | InChIKey=HGQGNOWAPYDBMZ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
