* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 2037533 |
| English Synonyms: | OTAVA-BB 2037533 |
| MDL Number.: | MFCD17261148 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1ccn(c(=O)c1)CCCO |
| InChi: | InChI=1S/C9H13NO2/c1-8-3-5-10(4-2-6-11)9(12)7-8/h3,5,7,11H,2,4,6H2,1H3 |
| InChiKey: | InChIKey=OMHDBBDQGGMISF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.