* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PROPAN-2-YL 2-(2-METHYL-1,4-OXAZEPAN-4-YL)ACETATE |
English Synonyms: | PROPAN-2-YL 2-(2-METHYL-1,4-OXAZEPAN-4-YL)ACETATE |
MDL Number.: | MFCD17261827 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CC1CN(CCCO1)CC(=O)OC(C)C |
InChi: | InChI=1S/C11H21NO3/c1-9(2)15-11(13)8-12-5-4-6-14-10(3)7-12/h9-10H,4-8H2,1-3H3 |
InChiKey: | InChIKey=AADDCRMUHGAHRM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.