* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(HYDROXYMETHYL)QUINOLIN-7-OL |
| English Synonyms: | 8-(HYDROXYMETHYL)QUINOLIN-7-OL |
| MDL Number.: | MFCD17267438 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1cc2ccc(c(c2nc1)CO)O |
| InChi: | InChI=1S/C10H9NO2/c12-6-8-9(13)4-3-7-2-1-5-11-10(7)8/h1-5,12-13H,6H2 |
| InChiKey: | InChIKey=GVRCVOIWXLSFMA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.