* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-AMINO-7-METHYL-QUINOLIN-2-OL |
| English Synonyms: | 8-AMINO-7-METHYL-QUINOLIN-2-OL |
| MDL Number.: | MFCD17267440 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | Cc1ccc2ccc(nc2c1N)O |
| InChi: | InChI=1S/C10H10N2O/c1-6-2-3-7-4-5-8(13)12-10(7)9(6)11/h2-5H,11H2,1H3,(H,12,13) |
| InChiKey: | InChIKey=RBIQLVMLRJTMEO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.