* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-AMINO-3,3-DIMETHYL-2,3-DIHYDRO-1H-INDEN-1-OL |
English Synonyms: | 6-AMINO-3,3-DIMETHYL-2,3-DIHYDRO-1H-INDEN-1-OL ; 6-AMINO-3,3-DIMETHYL-INDAN-1-OL |
MDL Number.: | MFCD17267461 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CC1(CC(c2c1ccc(c2)N)O)C |
InChi: | InChI=1S/C11H15NO/c1-11(2)6-10(13)8-5-7(12)3-4-9(8)11/h3-5,10,13H,6,12H2,1-2H3 |
InChiKey: | InChIKey=JLXSVICIDAARHB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.