* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PROPYL((1-[5-(1,3-THIAZOL-4-YL)-1,3,4-OXADIAZOL-2-YL]ETHYL))AMINE |
English Synonyms: | PROPYL((1-[5-(1,3-THIAZOL-4-YL)-1,3,4-OXADIAZOL-2-YL]ETHYL))AMINE |
MDL Number.: | MFCD17277421 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCCNC(C)c1nnc(o1)c2cscn2 |
InChi: | InChI=1S/C10H14N4OS/c1-3-4-11-7(2)9-13-14-10(15-9)8-5-16-6-12-8/h5-7,11H,3-4H2,1-2H3 |
InChiKey: | InChIKey=XMEHZTKYHKANFB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.