* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-CHLORO-4-N-(OXAN-4-YL)PYRIMIDINE-4,5-DIAMINE |
English Synonyms: | 6-CHLORO-4-N-(OXAN-4-YL)PYRIMIDINE-4,5-DIAMINE |
MDL Number.: | MFCD17277515 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1nc(c(c(n1)Cl)N)NC2CCOCC2 |
InChi: | InChI=1S/C9H13ClN4O/c10-8-7(11)9(13-5-12-8)14-6-1-3-15-4-2-6/h5-6H,1-4,11H2,(H,12,13,14) |
InChiKey: | InChIKey=XKACRROZUIVAOO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.