* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-ETHYNYL-3,4-DIHYDRO-2H-1,5-BENZODIOXEPINE |
| English Synonyms: | 7-ETHYNYL-3,4-DIHYDRO-2H-1,5-BENZODIOXEPINE |
| MDL Number.: | MFCD17281914 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C#Cc1ccc2c(c1)OCCCO2 |
| InChi: | InChI=1S/C11H10O2/c1-2-9-4-5-10-11(8-9)13-7-3-6-12-10/h1,4-5,8H,3,6-7H2 |
| InChiKey: | InChIKey=SOPMKYAIYRNANZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.