* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPYL(([5-(1H-PYRAZOL-4-YL)-1,3,4-OXADIAZOL-2-YL]METHYL))AMINE |
| English Synonyms: | PROPYL(([5-(1H-PYRAZOL-4-YL)-1,3,4-OXADIAZOL-2-YL]METHYL))AMINE |
| MDL Number.: | MFCD17289894 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCCNCc1nnc(o1)c2c[nH]nc2 |
| InChi: | InChI=1S/C9H13N5O/c1-2-3-10-6-8-13-14-9(15-8)7-4-11-12-5-7/h4-5,10H,2-3,6H2,1H3,(H,11,12) |
| InChiKey: | InChIKey=ZJAHKVMRYOXLCX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.