* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPYL((1-[5-(1H-PYRAZOL-4-YL)-1,3,4-OXADIAZOL-2-YL]ETHYL))AMINE |
| English Synonyms: | PROPYL((1-[5-(1H-PYRAZOL-4-YL)-1,3,4-OXADIAZOL-2-YL]ETHYL))AMINE |
| MDL Number.: | MFCD17289910 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCCNC(C)c1nnc(o1)c2c[nH]nc2 |
| InChi: | InChI=1S/C10H15N5O/c1-3-4-11-7(2)9-14-15-10(16-9)8-5-12-13-6-8/h5-7,11H,3-4H2,1-2H3,(H,12,13) |
| InChiKey: | InChIKey=CREDGICPFVSQSU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.