* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PROPYL((2-[5-(1H-PYRAZOL-4-YL)-1,3,4-OXADIAZOL-2-YL]ETHYL))AMINE |
English Synonyms: | PROPYL((2-[5-(1H-PYRAZOL-4-YL)-1,3,4-OXADIAZOL-2-YL]ETHYL))AMINE |
MDL Number.: | MFCD17289916 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCCNCCc1nnc(o1)c2c[nH]nc2 |
InChi: | InChI=1S/C10H15N5O/c1-2-4-11-5-3-9-14-15-10(16-9)8-6-12-13-7-8/h6-7,11H,2-5H2,1H3,(H,12,13) |
InChiKey: | InChIKey=UZQMSBLZFNQKCH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.