* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 4323747 |
| English Synonyms: | OTAVA-BB 4323747 |
| MDL Number.: | MFCD17313032 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | c1cc(c(nc1)N)C(=O)NC2CCS(=O)(=O)C2 |
| InChi: | InChI=1S/C10H13N3O3S/c11-9-8(2-1-4-12-9)10(14)13-7-3-5-17(15,16)6-7/h1-2,4,7H,3,5-6H2,(H2,11,12)(H,13,14) |
| InChiKey: | InChIKey=UWFDAXUUYODQHK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.