* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-HYDRAZINYL-7-METHYL-2H,3H-[1,4]DIOXINO[2,3-G]QUINOLINE |
English Synonyms: | 9-HYDRAZINYL-7-METHYL-2H,3H-[1,4]DIOXINO[2,3-G]QUINOLINE |
MDL Number.: | MFCD17321271 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1cc(c2cc3c(cc2n1)OCCO3)NN |
InChi: | InChI=1S/C12H13N3O2/c1-7-4-10(15-13)8-5-11-12(6-9(8)14-7)17-3-2-16-11/h4-6H,2-3,13H2,1H3,(H,14,15) |
InChiKey: | InChIKey=HNYIZXHUKYBMSR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.