* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH562535 |
| English Synonyms: | FCHGROUP FCH562535 |
| MDL Number.: | MFCD17325977 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCNCc1cccnc1N2CCS(=O)CC2 |
| InChi: | InChI=1S/C12H19N3OS/c1-2-13-10-11-4-3-5-14-12(11)15-6-8-17(16)9-7-15/h3-5,13H,2,6-10H2,1H3 |
| InChiKey: | InChIKey=FPHLCSRAVPYFDI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.