* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH569825 |
English Synonyms: | FCHGROUP FCH569825 |
MDL Number.: | MFCD17333135 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cnn(c1)CCC(=O)N2CCCC(C2)CCO |
InChi: | InChI=1S/C13H21N3O2/c17-10-5-12-3-1-7-15(11-12)13(18)4-9-16-8-2-6-14-16/h2,6,8,12,17H,1,3-5,7,9-11H2 |
InChiKey: | InChIKey=GRSVHBAFQJIGTE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.