* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH569855 |
| English Synonyms: | FCHGROUP FCH569855 |
| MDL Number.: | MFCD17333164 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc(sc1)/C=C/C(=O)N2CCCC(C2)CCO |
| InChi: | InChI=1S/C14H19NO2S/c16-9-7-12-3-1-8-15(11-12)14(17)6-5-13-4-2-10-18-13/h2,4-6,10,12,16H,1,3,7-9,11H2/b6-5+ |
| InChiKey: | InChIKey=SSTJAPRAWPBSLU-AATRIKPKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.