* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH569864 |
| English Synonyms: | FCHGROUP FCH569864 |
| MDL Number.: | MFCD17333173 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | c1cnc(=O)n(c1)CC(=O)N2CCCC(C2)CCO |
| InChi: | InChI=1S/C13H19N3O3/c17-8-4-11-3-1-6-15(9-11)12(18)10-16-7-2-5-14-13(16)19/h2,5,7,11,17H,1,3-4,6,8-10H2 |
| InChiKey: | InChIKey=NVHAQBYRNLDUKR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.