* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH570103 |
English Synonyms: | FCHGROUP FCH570103 |
MDL Number.: | MFCD17333404 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCn1ccnc1CNC2CCCc3c2cccc3 |
InChi: | InChI=1S/C16H21N3/c1-2-19-11-10-17-16(19)12-18-15-9-5-7-13-6-3-4-8-14(13)15/h3-4,6,8,10-11,15,18H,2,5,7,9,12H2,1H3 |
InChiKey: | InChIKey=FWBHKOINUQRHOG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.