* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-PHENYL-1,4-DIAZASPIRO[5.5]UNDECAN-5-ONE |
English Synonyms: | 9-PHENYL-1,4-DIAZASPIRO[5.5]UNDECAN-5-ONE |
MDL Number.: | MFCD17333579 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)C2CCC3(CC2)C(=O)NCCN3 |
InChi: | InChI=1S/C15H20N2O/c18-14-15(17-11-10-16-14)8-6-13(7-9-15)12-4-2-1-3-5-12/h1-5,13,17H,6-11H2,(H,16,18) |
InChiKey: | InChIKey=YQERVFAMARYTNT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.