* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 3627125 |
English Synonyms: | OTAVA-BB 3627125 |
MDL Number.: | MFCD17333804 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)OCC(=O)Nc2ccc(cn2)CN |
InChi: | InChI=1S/C14H15N3O2/c15-8-11-6-7-13(16-9-11)17-14(18)10-19-12-4-2-1-3-5-12/h1-7,9H,8,10,15H2,(H,16,17,18) |
InChiKey: | InChIKey=VIEOTGTVUWCBKS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.