* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH572927 |
| English Synonyms: | FCHGROUP FCH572927 |
| MDL Number.: | MFCD17335310 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | CCOC(=O)C(C)NC(=N)NC1CCCCC1 |
| InChi: | InChI=1S/C12H23N3O2/c1-3-17-11(16)9(2)14-12(13)15-10-7-5-4-6-8-10/h9-10H,3-8H2,1-2H3,(H3,13,14,15) |
| InChiKey: | InChIKey=NJIHQNHBPKLBBH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.