* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH572952 |
English Synonyms: | FCHGROUP FCH572952 |
MDL Number.: | MFCD17335335 |
H bond acceptor: | 5 |
H bond donor: | 4 |
Smile: | CCCNC(=O)C(C)NC(=N)NC1CCCCC1 |
InChi: | InChI=1S/C13H26N4O/c1-3-9-15-12(18)10(2)16-13(14)17-11-7-5-4-6-8-11/h10-11H,3-9H2,1-2H3,(H,15,18)(H3,14,16,17) |
InChiKey: | InChIKey=CURQSCZUYBTLMY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.