* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH573492 |
English Synonyms: | FCHGROUP FCH573492 |
MDL Number.: | MFCD17335858 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1cc(cc(c1)[N+](=O)[O-])/C=C/C(=O)NC2CCNC2 |
InChi: | InChI=1S/C13H15N3O3/c17-13(15-11-6-7-14-9-11)5-4-10-2-1-3-12(8-10)16(18)19/h1-5,8,11,14H,6-7,9H2,(H,15,17)/b5-4+ |
InChiKey: | InChIKey=NUHTYWYWHAGDPM-SNAWJCMRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.