* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH573497 |
| English Synonyms: | FCHGROUP FCH573497 |
| MDL Number.: | MFCD17335863 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(C)n1cc(cc1C(=O)NC2CCNC2)Br |
| InChi: | InChI=1S/C12H18BrN3O/c1-8(2)16-7-9(13)5-11(16)12(17)15-10-3-4-14-6-10/h5,7-8,10,14H,3-4,6H2,1-2H3,(H,15,17) |
| InChiKey: | InChIKey=RCCRFLIMMMTDGZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.