* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH577157 |
English Synonyms: | FCHGROUP FCH577157 |
MDL Number.: | MFCD17339451 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC1CC1NC(=O)c2ccc(cc2F)/C=C/C(=O)O |
InChi: | InChI=1S/C14H14FNO3/c1-8-6-12(8)16-14(19)10-4-2-9(7-11(10)15)3-5-13(17)18/h2-5,7-8,12H,6H2,1H3,(H,16,19)(H,17,18)/b5-3+ |
InChiKey: | InChIKey=YOLDGHJPQNILNX-HWKANZROSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.