* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH577442 |
English Synonyms: | FCHGROUP FCH577442 |
MDL Number.: | MFCD17339724 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1cc(n(n1)C)SCCCCC(C)(C#N)N |
InChi: | InChI=1S/C12H20N4S/c1-10-8-11(16(3)15-10)17-7-5-4-6-12(2,14)9-13/h8H,4-7,14H2,1-3H3 |
InChiKey: | InChIKey=CJXXRSAQOZLVLC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.