* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH577444 |
| English Synonyms: | FCHGROUP FCH577444 |
| MDL Number.: | MFCD17339726 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCNC(C)(CCSc1cc(nn1C)C)C#N |
| InChi: | InChI=1S/C13H22N4S/c1-5-7-15-13(3,10-14)6-8-18-12-9-11(2)16-17(12)4/h9,15H,5-8H2,1-4H3 |
| InChiKey: | InChIKey=CBGLRDKKPVJKKB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.