* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH580259 |
| English Synonyms: | FCHGROUP FCH580259 |
| MDL Number.: | MFCD17340541 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)C(CNC(C)C)N(Cc1ccco1)C2CC2 |
| InChi: | InChI=1S/C16H28N2O/c1-12(2)16(10-17-13(3)4)18(14-7-8-14)11-15-6-5-9-19-15/h5-6,9,12-14,16-17H,7-8,10-11H2,1-4H3 |
| InChiKey: | InChIKey=HFOVSPHNEVQUGV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.