* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH581346 |
English Synonyms: | FCHGROUP FCH581346 |
MDL Number.: | MFCD17341625 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCNCc1cc(oc1C)CN(C)CCC |
InChi: | InChI=1S/C14H26N2O/c1-5-7-15-10-13-9-14(17-12(13)3)11-16(4)8-6-2/h9,15H,5-8,10-11H2,1-4H3 |
InChiKey: | InChIKey=WNLLYOXBGUACMW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.