* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH583572 |
English Synonyms: | FCHGROUP FCH583572 |
MDL Number.: | MFCD17343856 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)CN(Cc1ccoc1CNC(C)C)C(C)C |
InChi: | InChI=1S/C16H30N2O/c1-12(2)10-18(14(5)6)11-15-7-8-19-16(15)9-17-13(3)4/h7-8,12-14,17H,9-11H2,1-6H3 |
InChiKey: | InChIKey=OHBKINPJWXGAHH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.