* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH991077 |
| English Synonyms: | FCHGROUP FCH991077 |
| MDL Number.: | MFCD17344610 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CNCc1ccc(cc1)COCc2ccco2 |
| InChi: | InChI=1S/C14H17NO2/c1-15-9-12-4-6-13(7-5-12)10-16-11-14-3-2-8-17-14/h2-8,15H,9-11H2,1H3 |
| InChiKey: | InChIKey=XVNGWBLWIUQRDT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.