* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH584683 |
| English Synonyms: | FCHGROUP FCH584683 |
| MDL Number.: | MFCD17344959 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCCOCCOCc1ccoc1CNC |
| InChi: | InChI=1S/C13H23NO3/c1-3-4-6-15-8-9-16-11-12-5-7-17-13(12)10-14-2/h5,7,14H,3-4,6,8-11H2,1-2H3 |
| InChiKey: | InChIKey=OSYSWPZEHMKWBY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.