* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH587795 |
English Synonyms: | FCHGROUP FCH587795 |
MDL Number.: | MFCD17348019 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | COCCC(C(=O)O)NC(=O)c1ccc(cc1)I |
InChi: | InChI=1S/C12H14INO4/c1-18-7-6-10(12(16)17)14-11(15)8-2-4-9(13)5-3-8/h2-5,10H,6-7H2,1H3,(H,14,15)(H,16,17) |
InChiKey: | InChIKey=BERQFMHNABKVAZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.