* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH590281 |
English Synonyms: | FCHGROUP FCH590281 |
MDL Number.: | MFCD17350449 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CN1CCN(C1=O)Cc2cc(cs2)/C=C/C(=O)O |
InChi: | InChI=1S/C12H14N2O3S/c1-13-4-5-14(12(13)17)7-10-6-9(8-18-10)2-3-11(15)16/h2-3,6,8H,4-5,7H2,1H3,(H,15,16)/b3-2+ |
InChiKey: | InChIKey=CYGSAWQUOGLBRY-NSCUHMNNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.