* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH590873 |
| English Synonyms: | FCHGROUP FCH590873 |
| MDL Number.: | MFCD17351019 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1cc(c(c(c1)Cl)/C(=N\O)/N)OC2CCCCCC2 |
| InChi: | InChI=1S/C14H19ClN2O2/c15-11-8-5-9-12(13(11)14(16)17-18)19-10-6-3-1-2-4-7-10/h5,8-10,18H,1-4,6-7H2,(H2,16,17) |
| InChiKey: | InChIKey=KVMPEQMXSSUXBS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.