* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH591430 |
English Synonyms: | FCHGROUP FCH591430 |
MDL Number.: | MFCD17351522 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | Cc1cc(ccc1S(=O)(=O)NCCOCCO)N |
InChi: | InChI=1S/C11H18N2O4S/c1-9-8-10(12)2-3-11(9)18(15,16)13-4-6-17-7-5-14/h2-3,8,13-14H,4-7,12H2,1H3 |
InChiKey: | InChIKey=WXCFQZJTQFPIEL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.