* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH591471 |
| English Synonyms: | FCHGROUP FCH591471 |
| MDL Number.: | MFCD17351560 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1c(c(sc1Cl)Cl)S(=O)(=O)NCCOCCO |
| InChi: | InChI=1S/C8H11Cl2NO4S2/c9-7-5-6(8(10)16-7)17(13,14)11-1-3-15-4-2-12/h5,11-12H,1-4H2 |
| InChiKey: | InChIKey=HHCDYYQZFDDZRU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.