* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH591473 |
English Synonyms: | FCHGROUP FCH591473 |
MDL Number.: | MFCD17351562 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cc(c(cc1S(=O)(=O)NCCOCCO)Cl)F |
InChi: | InChI=1S/C10H13ClFNO4S/c11-9-7-8(1-2-10(9)12)18(15,16)13-3-5-17-6-4-14/h1-2,7,13-14H,3-6H2 |
InChiKey: | InChIKey=SKGKOUMCNQRGPA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.