* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH591721 |
English Synonyms: | FCHGROUP FCH591721 |
MDL Number.: | MFCD17351809 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CNC(CCCc1cccs1)Cc2cccc(c2)Cl |
InChi: | InChI=1S/C16H20ClNS/c1-18-15(7-3-8-16-9-4-10-19-16)12-13-5-2-6-14(17)11-13/h2,4-6,9-11,15,18H,3,7-8,12H2,1H3 |
InChiKey: | InChIKey=WIJWVMPGVMWXMK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.