* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH592554 |
English Synonyms: | FCHGROUP FCH592554 |
MDL Number.: | MFCD17352625 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1ccc(c(c1)C(=O)Nc2cc(nn2C)C)NC |
InChi: | InChI=1S/C14H18N4O/c1-9-5-6-12(15-3)11(7-9)14(19)16-13-8-10(2)17-18(13)4/h5-8,15H,1-4H3,(H,16,19) |
InChiKey: | InChIKey=LBJSONRGUBGBRC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.